Structure of PDB 4cjq Chain A Binding Site BS01 |
|
|
Ligand ID | VXO |
InChI | InChI=1S/C25H28N2O5/c1-15(2)9-16(10-17-7-8-21-24(32-14-31-21)23(17)25(29)30)12-27-22(28)11-18-13-26-20-6-4-3-5-19(18)20/h3-8,13,15-16,26H,9-12,14H2,1-2H3,(H,27,28)(H,29,30)/t16-/m0/s1 |
InChIKey | MHGZHTDTSPSYHZ-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[CH](CNC(=O)Cc1c[nH]c2ccccc12)Cc3ccc4OCOc4c3C(O)=O | ACDLabs 12.01 | O=C(O)c1c(ccc2OCOc12)CC(CC(C)C)CNC(=O)Cc4c3ccccc3nc4 | OpenEye OEToolkits 1.7.6 | CC(C)CC(Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)Cc3c[nH]c4c3cccc4 | OpenEye OEToolkits 1.7.6 | CC(C)C[C@@H](Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)Cc3c[nH]c4c3cccc4 | CACTVS 3.385 | CC(C)C[C@H](CNC(=O)Cc1c[nH]c2ccccc12)Cc3ccc4OCOc4c3C(O)=O |
|
Formula | C25 H28 N2 O5 |
Name | 5-[(2S)-2-[[2-(1H-indol-3-yl)ethanoylamino]methyl]-4-methyl-pentyl]-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920997
|
PDB chain | 4cjq Chain A Residue 1214
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|