Structure of PDB 4cjl Chain A Binding Site BS01 |
|
|
Ligand ID | 9PA |
InChI | InChI=1S/C20H30N2O5/c1-13(2)9-14(11-22-17(23)5-3-4-8-21)10-15-6-7-16-19(27-12-26-16)18(15)20(24)25/h6-7,13-14H,3-5,8-12,21H2,1-2H3,(H,22,23)(H,24,25)/t14-/m0/s1 |
InChIKey | PPUJEZUKUJTCNK-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[C@H](CNC(=O)CCCCN)Cc1ccc2OCOc2c1C(O)=O | ACDLabs 12.01 | O=C(O)c1c(ccc2OCOc12)CC(CC(C)C)CNC(=O)CCCCN | OpenEye OEToolkits 1.7.6 | CC(C)CC(Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)CCCCN | CACTVS 3.385 | CC(C)C[CH](CNC(=O)CCCCN)Cc1ccc2OCOc2c1C(O)=O | OpenEye OEToolkits 1.7.6 | CC(C)C[C@@H](Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)CCCCN |
|
Formula | C20 H30 N2 O5 |
Name | 5-[(2S)-2-{[(5-aminopentanoyl)amino]methyl}-4-methylpentyl]-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921000
|
PDB chain | 4cjl Chain A Residue 1216
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|