Structure of PDB 4ciw Chain A Binding Site BS01 |
|
|
Ligand ID | XH2 |
InChI | InChI=1S/C9H14O6/c10-2-1-5-3-9(15,8(13)14)4-6(11)7(5)12/h3,6-7,10-12,15H,1-2,4H2,(H,13,14)/t6-,7-,9+/m1/s1 |
InChIKey | HVNZLWXJZRWNGG-BHNWBGBOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1C(C(C(=CC1(C(=O)O)O)CCO)O)O | CACTVS 3.385 | OCCC1=C[C@](O)(C[C@@H](O)[C@@H]1O)C(O)=O | OpenEye OEToolkits 1.7.6 | C1[C@H]([C@@H](C(=C[C@]1(C(=O)O)O)CCO)O)O | ACDLabs 12.01 | O=C(O)C1(O)C=C(CCO)C(O)C(O)C1 | CACTVS 3.385 | OCCC1=C[C](O)(C[CH](O)[CH]1O)C(O)=O |
|
Formula | C9 H14 O6 |
Name | (1R,4R,5R)-1,4,5-trihydroxy-3-(2-hydroxy)ethylcyclohex-2-ene-1-carboxylic acid |
ChEMBL | CHEMBL3233397 |
DrugBank | |
ZINC | ZINC000098209609
|
PDB chain | 4ciw Chain A Residue 1148
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|