Structure of PDB 4cik Chain A Binding Site BS01 |
|
|
Ligand ID | XO3 |
InChI | InChI=1S/C15H18N2O2/c18-15-10-14(19-17-15)12-6-7-16-13(9-12)8-11-4-2-1-3-5-11/h1-5,10,12-13,16H,6-9H2,(H,17,18)/t12-,13-/m0/s1 |
InChIKey | LNFPEBXLWIXQLF-STQMWFEESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1NOC(=C1)[CH]2CCN[CH](C2)Cc3ccccc3 | CACTVS 3.385 | O=C1NOC(=C1)[C@H]2CCN[C@H](C2)Cc3ccccc3 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C[C@H]2C[C@H](CCN2)C3=CC(=O)NO3 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)CC2CC(CCN2)C3=CC(=O)NO3 | ACDLabs 12.01 | O=C1C=C(ON1)C3CCNC(Cc2ccccc2)C3 |
|
Formula | C15 H18 N2 O2 |
Name | 5-[(2R,4S)-2-(phenylmethyl)piperidin-4-yl]-1,2-oxazol-3-one |
ChEMBL | CHEMBL3287849 |
DrugBank | |
ZINC | ZINC000098209612
|
PDB chain | 4cik Chain A Residue 1081
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.7: plasmin. |
|
|