Structure of PDB 4cey Chain A Binding Site BS01 |
|
|
Ligand ID | 906 |
InChI | InChI=1S/C23H31N5O3/c1-3-31-26-17-19-4-6-21(7-5-19)30-15-10-18(2)9-12-27-13-14-28(23(27)29)20-8-11-25-22(24)16-20/h4-8,11,16-18H,3,9-10,12-15H2,1-2H3,(H2,24,25)/b26-17+/t18-/m0/s1 |
InChIKey | SRJKGDFZRYDLKM-WYZSWBMLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCO/N=C/c1ccc(cc1)OCC[C@@H](C)CCN2CCN(C2=O)c3ccnc(c3)N | ACDLabs 12.01 | O=C2N(c1ccnc(N)c1)CCN2CCC(CCOc3ccc(\C=N\OCC)cc3)C | OpenEye OEToolkits 1.7.6 | CCON=Cc1ccc(cc1)OCCC(C)CCN2CCN(C2=O)c3ccnc(c3)N | CACTVS 3.385 | CCON=Cc1ccc(OCC[CH](C)CCN2CCN(C2=O)c3ccnc(N)c3)cc1 | CACTVS 3.385 | CCO/N=C/c1ccc(OCC[C@@H](C)CCN2CCN(C2=O)c3ccnc(N)c3)cc1 |
|
Formula | C23 H31 N5 O3 |
Name | 1-(2-aminopyridin-4-yl)-3-[(3S)-5-{4-[(E)-(ethoxyimino)methyl]phenoxy}-3-methylpentyl]imidazolidin-2-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208611
|
PDB chain | 4cey Chain A Residue 1298
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|