Structure of PDB 4ce3 Chain A Binding Site BS01 |
|
|
Ligand ID | L4V |
InChI | InChI=1S/C18H22ClNO4/c1-20-9-7-5-3-2-4-6-8-12(21)10-13-16(18(20)24)14(22)11-15(23)17(13)19/h2-3,11,22-23H,4-10H2,1H3/b3-2- |
InChIKey | XARNDFBZFLICCU-IHWYPQMZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1CCC\C=C/CCCC(=O)Cc2c(Cl)c(O)cc(O)c2C1=O | ACDLabs 12.01 | O=C2c1c(O)cc(O)c(Cl)c1CC(=O)CCCC=CCCCN2C | CACTVS 3.385 | CN1CCCC=CCCCC(=O)Cc2c(Cl)c(O)cc(O)c2C1=O | OpenEye OEToolkits 1.7.6 | CN1CCC/C=C\CCCC(=O)Cc2c(c(cc(c2Cl)O)O)C1=O | OpenEye OEToolkits 1.7.6 | CN1CCCC=CCCCC(=O)Cc2c(c(cc(c2Cl)O)O)C1=O |
|
Formula | C18 H22 Cl N O4 |
Name | 13-Chloro-14,16-dihydroxy-2-methyl-2,3,4,5,9,10-hexahydrobenz[c][1]azacyclotetradecine-1,11(8H,12H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921418
|
PDB chain | 4ce3 Chain A Residue 1215
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|