Structure of PDB 4ce2 Chain A Binding Site BS01 |
|
|
Ligand ID | BO5 |
InChI | InChI=1S/C19H24ClNO4/c1-21-10-8-6-4-2-3-5-7-9-13(22)11-14-17(19(21)25)15(23)12-16(24)18(14)20/h4,6,12,23-24H,2-3,5,7-11H2,1H3/b6-4+ |
InChIKey | WWDYZJACOLMKDH-GQCTYLIASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CN1CCC=CCCCCCC(=O)Cc2c(c(cc(c2Cl)O)O)C1=O | CACTVS 3.385 | CN1CC/C=C/CCCCCC(=O)Cc2c(Cl)c(O)cc(O)c2C1=O | OpenEye OEToolkits 1.9.2 | CN1CC/C=C/CCCCCC(=O)Cc2c(c(cc(c2Cl)O)O)C1=O | ACDLabs 12.01 | O=C2c1c(O)cc(O)c(Cl)c1CC(=O)CCCCCC=CCCN2C | CACTVS 3.385 | CN1CCC=CCCCCCC(=O)Cc2c(Cl)c(O)cc(O)c2C1=O |
|
Formula | C19 H24 Cl N O4 |
Name | (9E)-19-CHLORANYL-13-METHYL-16,18-BIS(OXIDANYL)-13-AZABICYCLO[13.4.0]NONADECA-1(15),9,16,18-TETRAENE-3,14-DIONE |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921283
|
PDB chain | 4ce2 Chain A Residue 1215
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|