Structure of PDB 4cdw Chain A Binding Site BS01 |
|
|
Ligand ID | VR2 |
InChI | InChI=1S/C20H24IN3O2/c1-16(9-15-26-19-4-2-17(21)3-5-19)8-12-23-13-14-24(20(23)25)18-6-10-22-11-7-18/h2-7,10-11,16H,8-9,12-15H2,1H3/t16-/m0/s1 |
InChIKey | SVYVYARVADIYRJ-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Ic3ccc(OCCC(CCN2C(=O)N(c1ccncc1)CC2)C)cc3 | CACTVS 3.385 | C[CH](CCOc1ccc(I)cc1)CCN2CCN(C2=O)c3ccncc3 | CACTVS 3.385 | C[C@H](CCOc1ccc(I)cc1)CCN2CCN(C2=O)c3ccncc3 | OpenEye OEToolkits 1.9.2 | C[C@@H](CCN1CCN(C1=O)c2ccncc2)CCOc3ccc(cc3)I | OpenEye OEToolkits 1.9.2 | CC(CCN1CCN(C1=O)c2ccncc2)CCOc3ccc(cc3)I |
|
Formula | C20 H24 I N3 O2 |
Name | 1-[(3S)-5-(4-iodanylphenoxy)-3-methyl-pentyl]-3-pyridin-4-yl-imidazolidin-2-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209537
|
PDB chain | 4cdw Chain A Residue 1298
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|