Structure of PDB 4ccu Chain A Binding Site BS01 |
|
|
Ligand ID | AWF |
InChI | InChI=1S/C22H23FN6O2S/c1-12-19(32-21(28-12)22(3,4)30)14-9-18(20(24)25-11-14)31-13(2)16-10-15(23)5-6-17(16)29-26-7-8-27-29/h5-11,13,30H,1-4H3,(H2,24,25)/t13-/m1/s1 |
InChIKey | ZRJMPUZTCOUGJH-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Fc2cc(c(n1nccn1)cc2)C(Oc4cc(c3sc(nc3C)C(O)(C)C)cnc4N)C | OpenEye OEToolkits 1.9.2 | Cc1c(sc(n1)C(C)(C)O)c2cc(c(nc2)N)OC(C)c3cc(ccc3n4nccn4)F | CACTVS 3.385 | C[CH](Oc1cc(cnc1N)c2sc(nc2C)C(C)(C)O)c3cc(F)ccc3n4nccn4 | OpenEye OEToolkits 1.9.2 | Cc1c(sc(n1)C(C)(C)O)c2cc(c(nc2)N)O[C@H](C)c3cc(ccc3n4nccn4)F | CACTVS 3.385 | C[C@@H](Oc1cc(cnc1N)c2sc(nc2C)C(C)(C)O)c3cc(F)ccc3n4nccn4 |
|
Formula | C22 H23 F N6 O2 S |
Name | 2-(5-(6-amino-5-((R)-1-(5-fluoro-2-(2H-1,2,3-triazol-2-yl)phenyl)ethoxy)pyridin-3-yl)-4-methylthiazol-2-yl)propan-2-ol |
ChEMBL | CHEMBL3128064 |
DrugBank | |
ZINC | ZINC000095921431
|
PDB chain | 4ccu Chain A Residue 1500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|