Structure of PDB 4cc6 Chain A Binding Site BS01 |
|
|
Ligand ID | L5Y |
InChI | InChI=1S/C14H12F3N5O/c15-14(16,17)12-6-8(19-3-4-23)5-10(20-12)13-9-1-2-18-7-11(9)21-22-13/h1-2,5-7,23H,3-4H2,(H,19,20)(H,21,22) |
InChIKey | CNTAIQDCYAEVFL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cncc2c1c(n[nH]2)c3cc(cc(n3)C(F)(F)F)NCCO | CACTVS 3.385 | OCCNc1cc(nc(c1)C(F)(F)F)c2n[nH]c3cnccc23 | ACDLabs 12.01 | FC(F)(F)c3nc(c2nnc1cnccc12)cc(NCCO)c3 |
|
Formula | C14 H12 F3 N5 O |
Name | 2-{[2-(1H-pyrazolo[3,4-c]pyridin-3-yl)-6-(trifluoromethyl)pyridin-4-yl]amino}ethanol |
ChEMBL | CHEMBL3099714 |
DrugBank | |
ZINC | ZINC000098209098
|
PDB chain | 4cc6 Chain A Residue 1311
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|