Structure of PDB 4cby Chain A Binding Site BS01 |
|
|
Ligand ID | KEE |
InChI | InChI=1S/C19H16N2O3/c22-19(21-23)18-16(13-4-2-1-3-5-13)17(18)14-8-6-12(7-9-14)15-10-20-11-24-15/h1-11,16-18,23H,(H,21,22)/t16-,17-,18-/m1/s1 |
InChIKey | PYWCXCBMYMFPTR-KZNAEPCWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | ONC(=O)[CH]1[CH]([CH]1c2ccc(cc2)c3ocnc3)c4ccccc4 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)[C@@H]2[C@H]([C@@H]2C(=O)NO)c3ccc(cc3)c4cnco4 | CACTVS 3.385 | ONC(=O)[C@@H]1[C@@H]([C@H]1c2ccc(cc2)c3ocnc3)c4ccccc4 | ACDLabs 12.01 | O=C(NO)C4C(c1ccccc1)C4c3ccc(c2ocnc2)cc3 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C2C(C2C(=O)NO)c3ccc(cc3)c4cnco4 |
|
Formula | C19 H16 N2 O3 |
Name | (1R,2R,3R)-2-[4-(1,3-oxazol-5-yl)phenyl]-N-oxidanyl-3-phenyl-cyclopropane-1-carboxamide |
ChEMBL | CHEMBL3110021 |
DrugBank | |
ZINC | ZINC000095920825
|
PDB chain | 4cby Chain A Residue 2033
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.98: histone deacetylase. |
|
|