Structure of PDB 4c9f Chain A Binding Site BS01 |
|
|
Ligand ID | GQ1 |
InChI | InChI=1S/C6H12O9S/c7-1-2-5(15-16(11,12)13)3(8)4(9)6(10)14-2/h2-10H,1H2,(H,11,12,13)/t2-,3-,4-,5-,6+/m1/s1 |
InChIKey | LOTQRUGOUKUSEY-UKFBFLRUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C(C1C(C(C(C(O1)O)O)O)OS(=O)(=O)O)O | CACTVS 3.385 | OC[CH]1O[CH](O)[CH](O)[CH](O)[CH]1O[S](O)(=O)=O | ACDLabs 12.01 | O=S(=O)(O)OC1C(OC(O)C(O)C1O)CO | OpenEye OEToolkits 1.7.6 | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)OS(=O)(=O)O)O | CACTVS 3.385 | OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O[S](O)(=O)=O |
|
Formula | C6 H12 O9 S |
Name | 4-O-sulfo-alpha-D-glucopyranose; 4-O-sulfo-alpha-D-glucose; 4-O-sulfo-D-glucose; 4-O-sulfo-glucose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000135965335
|
PDB chain | 4c9f Chain E Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|