Structure of PDB 4c4t Chain A Binding Site BS01 |
|
|
Ligand ID | GRX |
InChI | InChI=1S/C7H14FO8P/c8-7(17(13,14)15)6-5(12)4(11)3(10)2(1-9)16-6/h2-7,9-12H,1H2,(H2,13,14,15)/t2-,3-,4+,5-,6-,7+/m1/s1 |
InChIKey | BUPRWODHUABASJ-GEGSFZHJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)[C@@H](F)P(=O)(O)O)O)O)O)O | CACTVS 3.385 | OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)[C@@H](F)[P](O)(O)=O | OpenEye OEToolkits 1.9.2 | C(C1C(C(C(C(O1)C(F)P(=O)(O)O)O)O)O)O | CACTVS 3.385 | OC[CH]1O[CH]([CH](O)[CH](O)[CH]1O)[CH](F)[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)C(F)C1OC(C(O)C(O)C1O)CO |
|
Formula | C7 H14 F O8 P |
Name | (1R)-1,5-anhydro-1-[(S)-fluoro(phosphono)methyl]-D-glucitol; (S)-1-beta-phosphonofluoromethylene-1-deoxy-D-glucopyranose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208969
|
PDB chain | 4c4t Chain A Residue 1218
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|