Structure of PDB 4byi Chain A Binding Site BS01 |
|
|
Ligand ID | FH3 |
InChI | InChI=1S/C18H22ClN7O/c1-10-13(9-25(3)24-10)17-22-15-16(14(19)7-21-18(15)23-17)26-5-4-12(8-26)6-20-11(2)27/h7,9,12H,4-6,8H2,1-3H3,(H,20,27)(H,21,22,23)/t12-/m0/s1 |
InChIKey | KLKOJHYRAITDCX-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cn1cc(c(C)n1)c2[nH]c3ncc(Cl)c(N4CC[C@@H](CNC(C)=O)C4)c3n2 | OpenEye OEToolkits 1.9.2 | Cc1c(cn(n1)C)c2[nH]c3c(n2)c(c(cn3)Cl)N4CCC(C4)CNC(=O)C | OpenEye OEToolkits 1.9.2 | Cc1c(cn(n1)C)c2[nH]c3c(n2)c(c(cn3)Cl)N4CC[C@H](C4)CNC(=O)C | CACTVS 3.385 | Cn1cc(c(C)n1)c2[nH]c3ncc(Cl)c(N4CC[CH](CNC(C)=O)C4)c3n2 | ACDLabs 12.01 | O=C(NCC4CCN(c1c2nc(nc2ncc1Cl)c3cn(nc3C)C)C4)C |
|
Formula | C18 H22 Cl N7 O |
Name | (S)-N-((1-(6-chloro-2-(1,3-dimethyl-1H-pyrazol-4-yl)-3H-imidazo[4,5-b]pyridin-7-yl)pyrrolidin-3-yl)methyl)acetamide |
ChEMBL | CHEMBL3087778 |
DrugBank | |
ZINC | ZINC000095921385
|
PDB chain | 4byi Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|