Structure of PDB 4bs5 Chain A Binding Site BS01 |
|
|
Ligand ID | MG2 |
InChI | InChI=1S/C16H18F3N3O3S/c17-16(18,19)11-3-1-2-4-13(11)26(24,25)10-7-12(21-8-10)14(23)22-15(9-20)5-6-15/h1-4,9-10,12,20-21H,5-8H2,(H,22,23)/b20-9+/t10-,12+/m1/s1 |
InChIKey | WIKZXNNJWQPKLI-FGAGOUGJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | [H]/N=C/C1(CC1)NC(=O)[C@@H]2C[C@H](CN2)S(=O)(=O)c3ccccc3C(F)(F)F | CACTVS 3.385 | FC(F)(F)c1ccccc1[S](=O)(=O)[C@H]2CN[C@@H](C2)C(=O)NC3(CC3)C=N | OpenEye OEToolkits 1.9.2 | c1ccc(c(c1)C(F)(F)F)S(=O)(=O)C2CC(NC2)C(=O)NC3(CC3)C=N | CACTVS 3.385 | FC(F)(F)c1ccccc1[S](=O)(=O)[CH]2CN[CH](C2)C(=O)NC3(CC3)C=N | ACDLabs 12.01 | O=C(NC1(C=[N@H])CC1)C3NCC(S(=O)(=O)c2ccccc2C(F)(F)F)C3 |
|
Formula | C16 H18 F3 N3 O3 S |
Name | (2S,4R)-N-[1-(iminomethyl)cyclopropyl]-4-[2-(trifluoromethyl)phenyl]sulfonyl-pyrrolidine-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4bs5 Chain A Residue 1341
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|