Structure of PDB 4bqt Chain A Binding Site BS01 |
|
|
Ligand ID | C5E |
InChI | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
InChIKey | ANJTVLIZGCUXLD-DTWKUNHWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1[C@H]2CNC[C@@H]1C3=CC=CC(=O)N3C2 | ACDLabs 12.01 | O=C1C=CC=C2N1CC3CNCC2C3 | CACTVS 3.370 | O=C1C=CC=C2[CH]3CNC[CH](C3)CN12 | OpenEye OEToolkits 1.7.6 | C1C2CNCC1C3=CC=CC(=O)N3C2 | CACTVS 3.370 | O=C1C=CC=C2[C@H]3CNC[C@H](C3)CN12 |
|
Formula | C11 H14 N2 O |
Name | (1R,5S)-1,2,3,4,5,6-HEXAHYDRO-8H-1,5-METHANOPYRIDO[1,2-A][1,5]DIAZOCIN-8-ONE; CYTISINE |
ChEMBL | CHEMBL497939 |
DrugBank | DB09028 |
ZINC | ZINC000001599730
|
PDB chain | 4bqt Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|