Structure of PDB 4bjx Chain A Binding Site BS01 |
|
|
Ligand ID | 73B |
InChI | InChI=1S/C25H23ClN2O3/c1-15-13-23(27-21-10-8-20(26)9-11-21)22-14-19(7-12-24(22)28(15)16(2)29)17-3-5-18(6-4-17)25(30)31/h3-12,14-15,23,27H,13H2,1-2H3,(H,30,31)/t15-,23+/m0/s1 |
InChIKey | FAWSUKOIROHXAP-NPMXOYFQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H]1C[C@@H](Nc2ccc(Cl)cc2)c3cc(ccc3N1C(C)=O)c4ccc(cc4)C(O)=O | OpenEye OEToolkits 1.9.2 | CC1CC(c2cc(ccc2N1C(=O)C)c3ccc(cc3)C(=O)O)Nc4ccc(cc4)Cl | ACDLabs 12.01 | O=C(O)c4ccc(c1ccc3c(c1)C(Nc2ccc(Cl)cc2)CC(N3C(=O)C)C)cc4 | OpenEye OEToolkits 1.9.2 | C[C@H]1C[C@H](c2cc(ccc2N1C(=O)C)c3ccc(cc3)C(=O)O)Nc4ccc(cc4)Cl | CACTVS 3.385 | C[CH]1C[CH](Nc2ccc(Cl)cc2)c3cc(ccc3N1C(C)=O)c4ccc(cc4)C(O)=O |
|
Formula | C25 H23 Cl N2 O3 |
Name | 4-[(2S,4R)-1-acetyl-4-[(4-chlorophenyl)amino]-2-methyl-1,2,3,4-tetrahydroquinolin-6-yl]benzoic acid |
ChEMBL | CHEMBL2177300 |
DrugBank | |
ZINC | ZINC000095504909
|
PDB chain | 4bjx Chain A Residue 1169
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|