Structure of PDB 4bie Chain A Binding Site BS01 |
|
|
Ligand ID | IE6 |
InChI | InChI=1S/C14H16N4O2S2/c1-9-8-11-10(4-6-16-14(11)18-9)12-2-3-13(21-12)22(19,20)17-7-5-15/h2-4,6,8,17H,5,7,15H2,1H3,(H,16,18) |
InChIKey | AETIDEIXYCAWOW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1[nH]c2nccc(c3sc(cc3)[S](=O)(=O)NCCN)c2c1 | ACDLabs 12.01 | O=S(=O)(c3sc(c1c2c(ncc1)nc(c2)C)cc3)NCCN | OpenEye OEToolkits 1.9.2 | Cc1cc2c(ccnc2[nH]1)c3ccc(s3)S(=O)(=O)NCCN |
|
Formula | C14 H16 N4 O2 S2 |
Name | N-(2-aminoethyl)-5-{2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl}thiophene-2-sulfonamide |
ChEMBL | CHEMBL3330172 |
DrugBank | |
ZINC | ZINC000095921116
|
PDB chain | 4bie Chain A Residue 1942
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|