Structure of PDB 4bid Chain A Binding Site BS01 |
|
|
Ligand ID | IE8 |
InChI | InChI=1S/C24H20N4O2/c25-12-22(16-5-2-1-3-6-16)30-18-11-20(23(27-13-18)17-8-10-29-15-17)21-14-28-24-19(21)7-4-9-26-24/h1-11,13-15,22H,12,25H2,(H,26,28)/t22-/m0/s1 |
InChIKey | GQBPIQNQRCHGPJ-QFIPXVFZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)[C@H](CN)Oc2cc(c(nc2)c3ccoc3)c4c[nH]c5c4cccn5 | CACTVS 3.370 | NC[C@H](Oc1cnc(c2cocc2)c(c1)c3c[nH]c4ncccc34)c5ccccc5 | ACDLabs 12.01 | n2cc(OC(c1ccccc1)CN)cc(c2c3ccoc3)c5c4cccnc4nc5 | CACTVS 3.370 | NC[CH](Oc1cnc(c2cocc2)c(c1)c3c[nH]c4ncccc34)c5ccccc5 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C(CN)Oc2cc(c(nc2)c3ccoc3)c4c[nH]c5c4cccn5 |
|
Formula | C24 H20 N4 O2 |
Name | 5-[(1R)-2-amino-1-phenylethoxy]-2-(furan-3-yl)-3-{1H-pyrrolo[2,3-b]pyridin-3-yl}pyridine |
ChEMBL | CHEMBL3330168 |
DrugBank | |
ZINC | ZINC000095920830
|
PDB chain | 4bid Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|