Structure of PDB 4bcj Chain A Binding Site BS01 |
|
|
Ligand ID | T9N |
InChI | InChI=1S/C16H14N6OS/c1-9-14(24-16(18-2)20-9)13-10(7-17)8-19-15(22-13)21-11-4-3-5-12(23)6-11/h3-6,8,23H,1-2H3,(H,18,20)(H,19,21,22) |
InChIKey | NYRVLHGVDPPWJS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N#Cc1c(nc(nc1)Nc2cccc(O)c2)c3sc(nc3C)NC | OpenEye OEToolkits 1.9.2 | Cc1c(sc(n1)NC)c2c(cnc(n2)Nc3cccc(c3)O)C#N | CACTVS 3.385 | CNc1sc(c(C)n1)c2nc(Nc3cccc(O)c3)ncc2C#N |
|
Formula | C16 H14 N6 O S |
Name | 2-[(3-hydroxyphenyl)amino]-4-[4-methyl-2-(methylamino)-1,3-thiazol-5-yl]pyrimidine-5-carbonitrile |
ChEMBL | CHEMBL2312188 |
DrugBank | |
ZINC | ZINC000095596931
|
PDB chain | 4bcj Chain A Residue 1327
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|