Structure of PDB 4bcg Chain A Binding Site BS01 |
|
|
Ligand ID | T3C |
InChI | InChI=1S/C21H24N8S/c1-14-19(30-21(23-2)26-14)18-15(12-22)13-25-20(28-18)27-16-5-3-6-17(11-16)29-9-4-7-24-8-10-29/h3,5-6,11,13,24H,4,7-10H2,1-2H3,(H,23,26)(H,25,27,28) |
InChIKey | BKOYUSKBPMSUBK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNc1sc(c(C)n1)c2nc(Nc3cccc(c3)N4CCCNCC4)ncc2C#N | ACDLabs 12.01 | N#Cc1c(nc(nc1)Nc3cccc(N2CCCNCC2)c3)c4sc(nc4C)NC | OpenEye OEToolkits 1.9.2 | Cc1c(sc(n1)NC)c2c(cnc(n2)Nc3cccc(c3)N4CCCNCC4)C#N |
|
Formula | C21 H24 N8 S |
Name | 2-[[3-(1,4-diazepan-1-yl)phenyl]amino]-4-[4-methyl-2-(methylamino)-1,3-thiazol-5-yl]pyrimidine-5-carbonitrile |
ChEMBL | CHEMBL2312185 |
DrugBank | |
ZINC | ZINC000095597277
|
PDB chain | 4bcg Chain A Residue 1328
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|