Structure of PDB 4bcf Chain A Binding Site BS01 |
|
|
Ligand ID | T6Q |
InChI | InChI=1S/C23H26N8OS/c1-15-21(33-23(25-3)27-15)20-17(13-24)14-26-22(29-20)28-18-6-4-7-19(12-18)31-9-5-8-30(10-11-31)16(2)32/h4,6-7,12,14H,5,8-11H2,1-3H3,(H,25,27)(H,26,28,29) |
InChIKey | DZHBFQMOLIUZMP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNc1sc(c(C)n1)c2nc(Nc3cccc(c3)N4CCCN(CC4)C(C)=O)ncc2C#N | OpenEye OEToolkits 1.9.2 | Cc1c(sc(n1)NC)c2c(cnc(n2)Nc3cccc(c3)N4CCCN(CC4)C(=O)C)C#N | ACDLabs 12.01 | O=C(N4CCCN(c1cccc(c1)Nc2ncc(C#N)c(n2)c3sc(nc3C)NC)CC4)C |
|
Formula | C23 H26 N8 O S |
Name | 2-[[3-(4-ethanoyl-1,4-diazepan-1-yl)phenyl]amino]-4-[4-methyl-2-(methylamino)-1,3-thiazol-5-yl]pyrimidine-5-carbonitrile |
ChEMBL | CHEMBL2348651 |
DrugBank | |
ZINC | ZINC000095603671
|
PDB chain | 4bcf Chain A Residue 1327
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|