Structure of PDB 4b72 Chain A Binding Site BS01 |
|
|
Ligand ID | 2FB |
InChI | InChI=1S/C23H19N5OS/c1-14-27-20-21(30-14)23(28-22(20)24,17-6-8-19(29-2)9-7-17)18-5-3-4-15(10-18)16-11-25-13-26-12-16/h3-13H,1-2H3,(H2,24,28)/t23-/m1/s1 |
InChIKey | YQFNSFOVYAQJAF-HSZRJFAPSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(cc1)[C@@]2(N=C(N)c3nc(C)sc23)c4cccc(c4)c5cncnc5 | ACDLabs 12.01 | N2=C(c1nc(sc1C2(c3ccc(OC)cc3)c5cccc(c4cncnc4)c5)C)N | OpenEye OEToolkits 1.9.2 | Cc1nc2c(s1)C(N=C2N)(c3ccc(cc3)OC)c4cccc(c4)c5cncnc5 | CACTVS 3.385 | COc1ccc(cc1)[C]2(N=C(N)c3nc(C)sc23)c4cccc(c4)c5cncnc5 | OpenEye OEToolkits 1.9.2 | Cc1nc2c(s1)[C@@](N=C2N)(c3ccc(cc3)OC)c4cccc(c4)c5cncnc5 |
|
Formula | C23 H19 N5 O S |
Name | (6R)-6-(4-methoxyphenyl)-2-methyl-6-(3-pyrimidin-5-ylphenyl)pyrrolo[3,4-d][1,3]thiazol-4-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921168
|
PDB chain | 4b72 Chain A Residue 1503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|