Structure of PDB 4b2h Chain A Binding Site BS01 |
|
|
Ligand ID | C3F |
InChI | InChI=1S/C16H17N5O4/c1-8-6-10-11(7-9(8)2)21(5-3-4-17-16(24)25)13-12(18-10)14(22)20-15(23)19-13/h6-7,17H,3-5H2,1-2H3,(H,24,25)(H,20,22,23) |
InChIKey | SDVCPFDZIJESAH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cc2N=C3C(=O)NC(=O)N=C3N(CCCNC(O)=O)c2cc1C | ACDLabs 12.01 | O=C(O)NCCCN2C3=NC(=O)NC(=O)C3=Nc1cc(c(cc12)C)C | OpenEye OEToolkits 1.9.2 | Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CCCNC(=O)O |
|
Formula | C16 H17 N5 O4 |
Name | 3-[7,8-dimethyl-2,4-bis(oxidanylidene)benzo[g]pteridin-10-yl]propylcarbamic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921115
|
PDB chain | 4b2h Chain A Residue 103
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|