Structure of PDB 4b1d Chain A Binding Site BS01 |
|
|
Ligand ID | 6TG |
InChI | InChI=1S/C23H23N5O/c1-14-8-20(9-15(2)21(14)29-4)23(27-16(3)22(24)28-23)19-7-5-6-17(10-19)18-11-25-13-26-12-18/h5-13H,1-4H3,(H2,24,28)/t23-/m0/s1 |
InChIKey | PZSMDBYYYKPYFV-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | Cc1cc(cc(c1OC)C)[C@]2(N=C(C(=N2)N)C)c3cccc(c3)c4cncnc4 | OpenEye OEToolkits 1.9.2 | Cc1cc(cc(c1OC)C)C2(N=C(C(=N2)N)C)c3cccc(c3)c4cncnc4 | ACDLabs 12.01 | N1=C(C(=NC1(c2cc(c(OC)c(c2)C)C)c4cccc(c3cncnc3)c4)N)C | CACTVS 3.385 | COc1c(C)cc(cc1C)[C]2(N=C(C)C(=N2)N)c3cccc(c3)c4cncnc4 | CACTVS 3.385 | COc1c(C)cc(cc1C)[C@]2(N=C(C)C(=N2)N)c3cccc(c3)c4cncnc4 |
|
Formula | C23 H23 N5 O |
Name | (2S)-2-(4-methoxy-3,5-dimethylphenyl)-5-methyl-2-(3-pyrimidin-5-ylphenyl)-2H-imidazol-4-amine |
ChEMBL | CHEMBL2180030 |
DrugBank | |
ZINC | ZINC000068248221
|
PDB chain | 4b1d Chain A Residue 1505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|