Structure of PDB 4b1c Chain A Binding Site BS01 |
|
|
Ligand ID | 1B1 |
InChI | InChI=1S/C21H20N4/c1-3-5-15-10-17(13-23-12-15)16-6-4-7-19(11-16)21(18-8-9-18)24-14(2)20(22)25-21/h4,6-7,10-13,18H,8-9H2,1-2H3,(H2,22,25)/t21-/m1/s1 |
InChIKey | TWHSRVVFCICXII-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC#Cc1cc(cnc1)c2cccc(c2)C3(N=C(C(=N3)N)C)C4CC4 | OpenEye OEToolkits 1.9.2 | CC#Cc1cc(cnc1)c2cccc(c2)[C@@]3(N=C(C(=N3)N)C)C4CC4 | CACTVS 3.385 | CC#Cc1cncc(c1)c2cccc(c2)[C]3(N=C(C)C(=N3)N)C4CC4 | ACDLabs 12.01 | N1=C(C(=NC1(c3cccc(c2cc(C#CC)cnc2)c3)C4CC4)N)C | CACTVS 3.385 | CC#Cc1cncc(c1)c2cccc(c2)[C@@]3(N=C(C)C(=N3)N)C4CC4 |
|
Formula | C21 H20 N4 |
Name | (2R)-2-cyclopropyl-5-methyl-2-[3-(5-prop-1-yn-1-ylpyridin-3-yl)phenyl]-2H-imidazol-4-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095580344
|
PDB chain | 4b1c Chain A Residue 1504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|