Structure of PDB 4b05 Chain A Binding Site BS01 |
|
|
Ligand ID | 32D |
InChI | InChI=1S/C24H16F3N5/c25-19-6-2-5-18-21(19)23(28)32-24(18,17-7-8-31-20(10-17)22(26)27)16-4-1-3-14(9-16)15-11-29-13-30-12-15/h1-13,22H,(H2,28,32)/t24-/m0/s1 |
InChIKey | MRXBCEQZNKUUIP-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(cc(c1)[C@@]2(c3cccc(c3C(=N2)N)F)c4ccnc(c4)C(F)F)c5cncnc5 | OpenEye OEToolkits 1.9.2 | c1cc(cc(c1)C2(c3cccc(c3C(=N2)N)F)c4ccnc(c4)C(F)F)c5cncnc5 | CACTVS 3.385 | NC1=N[C](c2cccc(c2)c3cncnc3)(c4ccnc(c4)C(F)F)c5cccc(F)c15 | ACDLabs 12.01 | FC(F)c1nccc(c1)C3(N=C(c2c(F)cccc23)N)c5cccc(c4cncnc4)c5 | CACTVS 3.385 | NC1=N[C@@](c2cccc(c2)c3cncnc3)(c4ccnc(c4)C(F)F)c5cccc(F)c15 |
|
Formula | C24 H16 F3 N5 |
Name | (1S)-1-[2-(difluoromethyl)pyridin-4-yl]-4-fluoro-1-(3-pyrimidin-5-ylphenyl)-1H-isoindol-3-amine |
ChEMBL | CHEMBL2177913 |
DrugBank | DB12368 |
ZINC | ZINC000068205977
|
PDB chain | 4b05 Chain A Residue 1391
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|