Structure of PDB 4ak7 Chain A Binding Site BS01 |
|
|
Ligand ID | 47N |
InChI | InChI=1S/C12H20O10/c13-1-3-5(14)10(7(16)11(18)20-3)22-12-8(17)9-6(15)4(21-12)2-19-9/h3-18H,1-2H2/t3-,4+,5+,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
InChIKey | JWMBOBQNPBCYER-AHBMTURSSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[CH]1O[CH](O)[CH](O)[CH](O[CH]2O[CH]3CO[CH]([CH]3O)[CH]2O)[CH]1O | CACTVS 3.385 | OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O[C@@H]2O[C@H]3CO[C@H]([C@@H]3O)[C@@H]2O)[C@H]1O | ACDLabs 12.01 | O(C2OC1C(O)C(OC1)C2O)C3C(O)C(OC(O)C3O)CO | OpenEye OEToolkits 1.9.2 | C1C2C(C(O1)C(C(O2)OC3C(C(OC(C3O)O)CO)O)O)O | OpenEye OEToolkits 1.9.2 | C1[C@H]2[C@H]([C@@H](O1)[C@@H]([C@@H](O2)O[C@H]3[C@H]([C@H](O[C@H]([C@@H]3O)O)CO)O)O)O |
|
Formula | C12 H20 O10 |
Name | NEOAGAROBIOSE |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095635529
|
PDB chain | 4ak7 Chain A Residue 1402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
I44 |
Catalytic site (residue number reindexed from 1) |
I12 |
Enzyme Commision number |
? |
|
|
|