Structure of PDB 4acu Chain A Binding Site BS01 |
|
|
Ligand ID | QN7 |
InChI | InChI=1S/C24H20F3N5O/c1-33-19-7-3-6-18(20(19)25)15-4-2-5-17(12-15)24(16-8-10-29-11-9-16)21-30-13-23(26,27)14-32(21)22(28)31-24/h2-12H,13-14H2,1H3,(H2,28,31)/t24-/m1/s1 |
InChIKey | RECVUKARQVUVBY-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | COc1cccc(c1F)c2cccc(c2)[C@@]3(C4=NCC(CN4C(=N3)N)(F)F)c5ccncc5 | ACDLabs 12.01 | Fc1c(OC)cccc1c2cccc(c2)C4(N=C(N)N3C4=NCC(F)(F)C3)c5ccncc5 | CACTVS 3.385 | COc1cccc(c1F)c2cccc(c2)[C]3(N=C(N)N4CC(F)(F)CN=C34)c5ccncc5 | OpenEye OEToolkits 1.9.2 | COc1cccc(c1F)c2cccc(c2)C3(C4=NCC(CN4C(=N3)N)(F)F)c5ccncc5 | CACTVS 3.385 | COc1cccc(c1F)c2cccc(c2)[C@]3(N=C(N)N4CC(F)(F)CN=C34)c5ccncc5 |
|
Formula | C24 H20 F3 N5 O |
Name | (8S)-3,3-DIFLUORO-8-(2'-FLUORO-3'-METHOXYBIPHENYL-3-YL)-8-PYRIDIN-4-YL-2,3,4,8-TETRAHYDROIMIDAZO[1,5-A]PYRIMIDIN-6-AMINE |
ChEMBL | CHEMBL3260842 |
DrugBank | |
ZINC | ZINC000073294933
|
PDB chain | 4acu Chain A Residue 1506
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|