Structure of PDB 3zze Chain A Binding Site BS01 |
|
|
Ligand ID | 6XP |
InChI | InChI=1S/C18H18ClN3O3/c1-9-3-8-13(19)14-15(9)20-18(25)16(14)21-22-17(24)10(2)11-4-6-12(23)7-5-11/h3-8,10,16,21,23H,1-2H3,(H,20,25)(H,22,24)/t10-,16?/m0/s1 |
InChIKey | QYEVTRORXICGHU-VQVVDHBBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](C(=O)NN[CH]1C(=O)Nc2c(C)ccc(Cl)c12)c3ccc(O)cc3 | OpenEye OEToolkits 1.9.2 | Cc1ccc(c2c1NC(=O)C2NNC(=O)[C@@H](C)c3ccc(cc3)O)Cl | ACDLabs 12.01 | Clc1ccc(c2c1C(C(=O)N2)NNC(=O)C(c3ccc(O)cc3)C)C | OpenEye OEToolkits 1.9.2 | Cc1ccc(c2c1NC(=O)C2NNC(=O)C(C)c3ccc(cc3)O)Cl | CACTVS 3.385 | C[C@H](C(=O)NN[C@H]1C(=O)Nc2c(C)ccc(Cl)c12)c3ccc(O)cc3 |
|
Formula | C18 H18 Cl N3 O3 |
Name | (2S)-N'-[(3R)-4-chloro-7-methyl-2-oxo-2,3-dihydro-1H-indol-3-yl]-2-(4-hydroxyphenyl)propanehydrazide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3zze Chain A Residue 2345
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|