Structure of PDB 3zmg Chain A Binding Site BS01 |
|
|
Ligand ID | 6Z0 |
InChI | InChI=1S/C18H14F3N5O2/c1-17(18(20,21)9-28-16(23)26-17)12-6-11(3-4-13(12)19)25-15(27)14-5-2-10(7-22)8-24-14/h2-6,8H,9H2,1H3,(H2,23,26)(H,25,27)/t17-/m1/s1 |
InChIKey | DVMUZHLUMHPCGZ-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | [H]/N=C\1/N[C@](C(CO1)(F)F)(C)c2cc(ccc2F)NC(=O)c3ccc(cn3)C#N | OpenEye OEToolkits 1.9.2 | CC1(C(COC(=N)N1)(F)F)c2cc(ccc2F)NC(=O)c3ccc(cn3)C#N | ACDLabs 12.01 | FC1(F)C(NC(=[N@H])OC1)(c3cc(NC(=O)c2ncc(C#N)cc2)ccc3F)C | CACTVS 3.385 | C[C]1(NC(=N)OCC1(F)F)c2cc(NC(=O)c3ccc(cn3)C#N)ccc2F | CACTVS 3.385 | C[C@@]1(NC(=N)OCC1(F)F)c2cc(NC(=O)c3ccc(cn3)C#N)ccc2F |
|
Formula | C18 H14 F3 N5 O2 |
Name | N-[3-[(4R)-2-azanylidene-5,5-bis(fluoranyl)-4-methyl-1,3-oxazinan-4-yl]-4-fluoranyl-phenyl]-5-cyano-pyridine-2-carboxamide |
ChEMBL | CHEMBL2347215 |
DrugBank | |
ZINC | ZINC000095602954
|
PDB chain | 3zmg Chain A Residue 1448
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|