Structure of PDB 3zln Chain A Binding Site BS01 |
|
|
Ligand ID | H0Y |
InChI | InChI=1S/C23H18N4O2S/c28-22(29)20-9-4-7-17(24-20)15-12-11-14-5-3-8-18(16(14)13-15)26-27-23-25-19-6-1-2-10-21(19)30-23/h1-2,4,6-7,9-13H,3,5,8H2,(H,25,27)(H,28,29)/b26-18+ |
InChIKey | ZGERKAMDOWOUTN-NLRVBDNBSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)c1nc(ccc1)c2ccc5c(c2)/C(=N/Nc3nc4ccccc4s3)CCC5 | OpenEye OEToolkits 1.9.2 | c1ccc2c(c1)nc(s2)N/N=C/3\CCCc4c3cc(cc4)c5cccc(n5)C(=O)O | CACTVS 3.385 | OC(=O)c1cccc(n1)c2ccc3CCC\C(=N/Nc4sc5ccccc5n4)c3c2 | OpenEye OEToolkits 1.9.2 | c1ccc2c(c1)nc(s2)NN=C3CCCc4c3cc(cc4)c5cccc(n5)C(=O)O | CACTVS 3.385 | OC(=O)c1cccc(n1)c2ccc3CCCC(=NNc4sc5ccccc5n4)c3c2 |
|
Formula | C23 H18 N4 O2 S |
Name | 6-[(8E)-8-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7-dihydro-5H-naphthalen-2-yl]pyridine-2-carboxylic acid |
ChEMBL | CHEMBL3287282 |
DrugBank | |
ZINC | ZINC000095920917
|
PDB chain | 3zln Chain A Residue 1197
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|