Structure of PDB 3zi0 Chain A Binding Site BS01 |
|
|
Ligand ID | FM8 |
InChI | InChI=1S/C19H19Cl2N4O5P/c20-16-6-5-13(9-17(16)21)18(31(28,29)30)7-8-25(27)19(26)15-4-2-1-3-14(15)10-24-12-22-11-23-24/h1-6,9,11-12,18,27H,7-8,10H2,(H2,28,29,30)/t18-/m0/s1 |
InChIKey | CGKYBZFXVQNZBL-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | ON(CC[CH](c1ccc(Cl)c(Cl)c1)[P](O)(O)=O)C(=O)c2ccccc2Cn3cncn3 | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)Cn2cncn2)C(=O)N(CC[C@@H](c3ccc(c(c3)Cl)Cl)P(=O)(O)O)O | CACTVS 3.370 | ON(CC[C@@H](c1ccc(Cl)c(Cl)c1)[P](O)(O)=O)C(=O)c2ccccc2Cn3cncn3 | ACDLabs 12.01 | Clc1ccc(cc1Cl)C(P(=O)(O)O)CCN(O)C(=O)c2ccccc2Cn3ncnc3 | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)Cn2cncn2)C(=O)N(CCC(c3ccc(c(c3)Cl)Cl)P(=O)(O)O)O |
|
Formula | C19 H19 Cl2 N4 O5 P |
Name | [(1S)-1-(3,4-dichlorophenyl)-3-{hydroxy[2-(1H-1,2,4-triazol-1-ylmethyl)benzoyl]amino}propyl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000096273634
|
PDB chain | 3zi0 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
Biological Process |
GO:0008299 |
isoprenoid biosynthetic process |
GO:0019288 |
isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway |
GO:0051483 |
terpenoid biosynthetic process, mevalonate-independent |
GO:0051484 |
isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway involved in terpenoid biosynthetic process |
|
|