Structure of PDB 3zdu Chain A Binding Site BS01 |
|
|
Ligand ID | 38R |
InChI | InChI=1S/C20H21N7/c21-11-9-14-5-7-16(8-6-14)23-20-22-12-10-18(25-20)24-19-13-17(26-27-19)15-3-1-2-4-15/h5-8,10,12-13,15H,1-4,9H2,(H3,22,23,24,25,26,27) |
InChIKey | VKAOLAKWGBXOCQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(ccc1CC#N)Nc2nccc(n2)Nc3cc(n[nH]3)C4CCCC4 | CACTVS 3.385 | N#CCc1ccc(Nc2nccc(Nc3[nH]nc(c3)C4CCCC4)n2)cc1 | ACDLabs 12.01 | N#CCc1ccc(cc1)Nc2nccc(n2)Nc3cc(nn3)C4CCCC4 |
|
Formula | C20 H21 N7 |
Name | [4-({4-[(3-cyclopentyl-1H-pyrazol-5-yl)amino]pyrimidin-2-yl}amino)phenyl]acetonitrile |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920754
|
PDB chain | 3zdu Chain A Residue 350
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|