Structure of PDB 3x44 Chain A Binding Site BS01 |
|
|
Ligand ID | PUS |
InChI | InChI=1S/C12H17N4O9P/c1-6-10(17)8(7(2-14-6)4-25-26(21,22)23)3-15-9(11(18)19)5-24-16-12(13)20/h2-3,9,17H,4-5H2,1H3,(H,18,19)(H3,13,16,20)(H2,21,22,23)/b15-3+/t9-/m0/s1 |
InChIKey | LKTMSPZJJUSLRR-FUOCOAHQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)C=NC(CONC(=O)N)C(=O)O)O | ACDLabs 12.01 | N(/C(CONC(N)=O)C(O)=O)=C\c1c(c(ncc1COP(O)(=O)O)C)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C=N[CH](CONC(N)=O)C(O)=O)c1O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)/C=N/[C@@H](CONC(=O)N)C(=O)O)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C=N[C@@H](CONC(N)=O)C(O)=O)c1O |
|
Formula | C12 H17 N4 O9 P |
Name | (E)-O-(carbamoylamino)-N-({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene)-L-serine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620707
|
PDB chain | 3x44 Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
A43 S265 |
Catalytic site (residue number reindexed from 1) |
A42 S264 |
Enzyme Commision number |
2.5.1.47: cysteine synthase. 2.6.99.3: O-ureido-L-serine synthase. |
|
|
|