Structure of PDB 3wzk Chain A Binding Site BS01 |
|
|
Ligand ID | O23 |
InChI | InChI=1S/C21H19N5OS/c27-21(25-16-7-8-16)15-5-3-14(4-6-15)18-13-24-20-19(22-9-10-26(18)20)23-12-17-2-1-11-28-17/h1-6,9-11,13,16H,7-8,12H2,(H,22,23)(H,25,27) |
InChIKey | YUHKXKGPLTYXSO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(sc1)CNc2c3ncc(n3ccn2)c4ccc(cc4)C(=O)NC5CC5 | ACDLabs 12.01 | O=C(NC1CC1)c2ccc(cc2)c3cnc4c(nccn34)NCc5sccc5 | CACTVS 3.385 | O=C(NC1CC1)c2ccc(cc2)c3cnc4n3ccnc4NCc5sccc5 |
|
Formula | C21 H19 N5 O S |
Name | N-cyclopropyl-4-{8-[(thiophen-2-ylmethyl)amino]imidazo[1,2-a]pyrazin-3-yl}benzamide |
ChEMBL | CHEMBL3410069 |
DrugBank | |
ZINC | ZINC000200237140
|
PDB chain | 3wzk Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|