Structure of PDB 3wzj Chain A Binding Site BS01 |
|
|
Ligand ID | O43 |
InChI | InChI=1S/C28H36N6O2/c35-28(32-23-10-11-23)21-8-6-20(7-9-21)25-18-30-27-24(29-17-19-12-14-36-15-13-19)16-26(33-34(25)27)31-22-4-2-1-3-5-22/h6-9,16,18-19,22-23,29H,1-5,10-15,17H2,(H,31,33)(H,32,35) |
InChIKey | ZOSFYOBMRYUXAN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C(NC1CC1)c2ccc(cc2)c3cnc4n3nc(NC5CCCCC5)cc4NCC6CCOCC6 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1c2cnc3n2nc(cc3NCC4CCOCC4)NC5CCCCC5)C(=O)NC6CC6 | ACDLabs 12.01 | O=C(NC1CC1)c2ccc(cc2)c4cnc5c(NCC3CCOCC3)cc(nn45)NC6CCCCC6 |
|
Formula | C28 H36 N6 O2 |
Name | 4-{6-(cyclohexylamino)-8-[(tetrahydro-2H-pyran-4-ylmethyl)amino]imidazo[1,2-b]pyridazin-3-yl}-N-cyclopropylbenzamide |
ChEMBL | CHEMBL3410080 |
DrugBank | |
ZINC | ZINC000215991650
|
PDB chain | 3wzj Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|