Structure of PDB 3wfg Chain A Binding Site BS01 |
|
|
Ligand ID | WFG |
InChI | InChI=1S/C19H14FNO4/c1-10-17(12-4-7-15-14(8-12)21-16(22)9-24-15)18(19(23)25-10)11-2-5-13(20)6-3-11/h2-8,10H,9H2,1H3,(H,21,22)/t10-/m0/s1 |
InChIKey | FLUKKJOWQPEDIT-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@H]1C(=C(C(=O)O1)c2ccc(cc2)F)c3ccc4c(c3)NC(=O)CO4 | OpenEye OEToolkits 1.7.6 | CC1C(=C(C(=O)O1)c2ccc(cc2)F)c3ccc4c(c3)NC(=O)CO4 | ACDLabs 12.01 | Fc4ccc(C=3C(=O)OC(C=3c2cc1c(OCC(=O)N1)cc2)C)cc4 | CACTVS 3.385 | C[CH]1OC(=O)C(=C1c2ccc3OCC(=O)Nc3c2)c4ccc(F)cc4 | CACTVS 3.385 | C[C@@H]1OC(=O)C(=C1c2ccc3OCC(=O)Nc3c2)c4ccc(F)cc4 |
|
Formula | C19 H14 F N O4 |
Name | 6-[(2S)-4-(4-fluorophenyl)-2-methyl-5-oxo-2,5-dihydrofuran-3-yl]-2H-1,4-benzoxazin-3(4H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920588
|
PDB chain | 3wfg Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|