Structure of PDB 3wce Chain A Binding Site BS01 |
|
|
Ligand ID | ER4 |
InChI | InChI=1S/C25H30N2O3/c1-29-16-5-17-30-24-9-8-21(23(26-24)18-20-6-3-2-4-7-20)10-13-25(28)19-27-14-11-22(25)12-15-27/h2-4,6-9,22,28H,5,11-12,14-19H2,1H3/t25-/m1/s1 |
InChIKey | HVIKCINYHLGLMN-RUZDIDTESA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | OC4(C#Cc1ccc(OCCCOC)nc1Cc2ccccc2)C3CCN(CC3)C4 | CACTVS 3.370 | COCCCOc1ccc(C#C[C@@]2(O)CN3CCC2CC3)c(Cc4ccccc4)n1 | OpenEye OEToolkits 1.7.6 | COCCCOc1ccc(c(n1)Cc2ccccc2)C#CC3(CN4CCC3CC4)O | CACTVS 3.370 | COCCCOc1ccc(C#C[C]2(O)CN3CCC2CC3)c(Cc4ccccc4)n1 | OpenEye OEToolkits 1.7.6 | COCCCOc1ccc(c(n1)Cc2ccccc2)C#C[C@]3(CN4CCC3CC4)O |
|
Formula | C25 H30 N2 O3 |
Name | (3R)-3-{[2-benzyl-6-(3-methoxypropoxy)pyridin-3-yl]ethynyl}-1-azabicyclo[2.2.2]octan-3-ol |
ChEMBL | CHEMBL258503 |
DrugBank | |
ZINC | ZINC000003817776
|
PDB chain | 3wce Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|