Structure of PDB 3wb5 Chain A Binding Site BS01 |
|
|
Ligand ID | 0B4 |
InChI | InChI=1S/C15H19N3O/c1-15(9-13(19)18(2)14(16)17-15)12-8-11(12)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3,(H2,16,17)/t11-,12+,15-/m0/s1 |
InChIKey | YBXYDJCRBQOXMI-ZOWXZIJZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@]1(CC(=O)N(C(=N1)N)C)[C@@H]2C[C@H]2c3ccccc3 | OpenEye OEToolkits 1.7.6 | CC1(CC(=O)N(C(=N1)N)C)C2CC2c3ccccc3 | CACTVS 3.385 | CN1C(=O)C[C](C)(N=C1N)[CH]2C[CH]2c3ccccc3 | CACTVS 3.385 | CN1C(=O)C[C@](C)(N=C1N)[C@@H]2C[C@H]2c3ccccc3 | ACDLabs 12.01 | O=C3N(C(=NC(C2CC2c1ccccc1)(C3)C)N)C |
|
Formula | C15 H19 N3 O |
Name | (6S)-2-amino-3,6-dimethyl-6-[(1R,2R)-2-phenylcyclopropyl]-5,6-dihydropyrimidin-4(3H)-one |
ChEMBL | CHEMBL3040534 |
DrugBank | |
ZINC | ZINC000095920555
|
PDB chain | 3wb5 Chain A Residue 507
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|