Structure of PDB 3w7e Chain A Binding Site BS01 |
|
|
Ligand ID | W7F |
InChI | InChI=1S/C18H16N2O5/c1-25-12-7-5-10-3-2-4-11(14(10)9-12)6-8-13-15(17(22)23)19-18(24)20-16(13)21/h2-5,7,9H,6,8H2,1H3,(H,22,23)(H2,19,20,21,24) |
InChIKey | YMSWTHCRKDTGCQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1ccc2cccc(CCC3=C(NC(=O)NC3=O)C(O)=O)c2c1 | OpenEye OEToolkits 1.7.6 | COc1ccc2cccc(c2c1)CCC3=C(NC(=O)NC3=O)C(=O)O | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc3c2cc(OC)ccc2ccc3 |
|
Formula | C18 H16 N2 O5 |
Name | 5-[2-(7-methoxynaphthalen-1-yl)ethyl]-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990625 |
DrugBank | |
ZINC | ZINC000098209557
|
PDB chain | 3w7e Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|