Structure of PDB 3w74 Chain A Binding Site BS01 |
|
|
Ligand ID | W74 |
InChI | InChI=1S/C14H11F3N2O5/c15-14(16,17)24-8-4-1-7(2-5-8)3-6-9-10(12(21)22)18-13(23)19-11(9)20/h1-2,4-5H,3,6H2,(H,21,22)(H2,18,19,20,23) |
InChIKey | OMXOEMCOOCDBTO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)C1=C(CCc2ccc(OC(F)(F)F)cc2)C(=O)NC(=O)N1 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1CCC2=C(NC(=O)NC2=O)C(=O)O)OC(F)(F)F | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2ccc(OC(F)(F)F)cc2 |
|
Formula | C14 H11 F3 N2 O5 |
Name | 2,6-dioxo-5-{2-[4-(trifluoromethoxy)phenyl]ethyl}-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990946 |
DrugBank | |
ZINC | ZINC000098209550
|
PDB chain | 3w74 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|