Structure of PDB 3w73 Chain A Binding Site BS01 |
|
|
Ligand ID | W73 |
InChI | InChI=1S/C21H16N2O4/c24-19-17(18(20(25)26)22-21(27)23-19)10-9-13-11-12-5-1-2-6-14(12)16-8-4-3-7-15(13)16/h1-8,11H,9-10H2,(H,25,26)(H2,22,23,24,27) |
InChIKey | ALPWFSMWGPSLIH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)cc(c3c2cccc3)CCC4=C(NC(=O)NC4=O)C(=O)O | CACTVS 3.370 | OC(=O)C1=C(CCc2cc3ccccc3c4ccccc24)C(=O)NC(=O)N1 |
|
Formula | C21 H16 N2 O4 |
Name | 2,6-dioxo-5-[2-(phenanthren-9-yl)ethyl]-1,2,3,6- tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3991296 |
DrugBank | |
ZINC | ZINC000098209549
|
PDB chain | 3w73 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|