Structure of PDB 3w2m Chain A Binding Site BS01 |
|
|
Ligand ID | ZRO |
InChI | InChI=1S/C14H11F3N2O4/c15-14(16,17)8-4-1-7(2-5-8)3-6-9-10(12(21)22)18-13(23)19-11(9)20/h1-2,4-5H,3,6H2,(H,21,22)(H2,18,19,20,23) |
InChIKey | DDORHAWNAXTQBY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1CCC2=C(NC(=O)NC2=O)C(=O)O)C(F)(F)F | CACTVS 3.370 | OC(=O)C1=C(CCc2ccc(cc2)C(F)(F)F)C(=O)NC(=O)N1 | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2ccc(cc2)C(F)(F)F |
|
Formula | C14 H11 F3 N2 O4 |
Name | 2,6-dioxo-5-{2-[4-(trifluoromethyl)phenyl]ethyl}-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3991294 |
DrugBank | |
ZINC | ZINC000095920757
|
PDB chain | 3w2m Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|