Structure of PDB 3w2k Chain A Binding Site BS01 |
|
|
Ligand ID | KRO |
InChI | InChI=1S/C14H13FN2O4/c1-7-6-8(3-5-10(7)15)2-4-9-11(13(19)20)16-14(21)17-12(9)18/h3,5-6H,2,4H2,1H3,(H,19,20)(H2,16,17,18,21) |
InChIKey | ZLAJUTPBANPKKJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2ccc(F)c(c2)C | OpenEye OEToolkits 1.7.6 | Cc1cc(ccc1F)CCC2=C(NC(=O)NC2=O)C(=O)O | CACTVS 3.370 | Cc1cc(CCC2=C(NC(=O)NC2=O)C(O)=O)ccc1F |
|
Formula | C14 H13 F N2 O4 |
Name | 5-[2-(4-fluoro-3-methylphenyl)ethyl]-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990191 |
DrugBank | |
ZINC | ZINC000095921083
|
PDB chain | 3w2k Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|