Structure of PDB 3w23 Chain A Binding Site BS01 |
|
|
Ligand ID | 3RO |
InChI | InChI=1S/C13H11ClN2O4/c14-8-3-1-2-7(6-8)4-5-9-10(12(18)19)15-13(20)16-11(9)17/h1-3,6H,4-5H2,(H,18,19)(H2,15,16,17,20) |
InChIKey | QORUWPNKQKIBAJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)Cl)CCC2=C(NC(=O)NC2=O)C(=O)O | CACTVS 3.370 | OC(=O)C1=C(CCc2cccc(Cl)c2)C(=O)NC(=O)N1 | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2cccc(Cl)c2 |
|
Formula | C13 H11 Cl N2 O4 |
Name | 5-[2-(3-chlorophenyl)ethyl]-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990764 |
DrugBank | |
ZINC | ZINC000095920707
|
PDB chain | 3w23 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|