Structure of PDB 3w1x Chain A Binding Site BS01 |
|
|
Ligand ID | XRO |
InChI | InChI=1S/C15H13N3O4/c16-8-7-10-3-1-9(2-4-10)5-6-11-12(14(20)21)17-15(22)18-13(11)19/h1-4H,5-7H2,(H,20,21)(H2,17,18,19,22) |
InChIKey | HLSGPFKGIFERQZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1CCC2=C(NC(=O)NC2=O)C(=O)O)CC#N | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2ccc(cc2)CC#N | CACTVS 3.370 | OC(=O)C1=C(CCc2ccc(CC#N)cc2)C(=O)NC(=O)N1 |
|
Formula | C15 H13 N3 O4 |
Name | 5-{2-[4-(cyanomethyl)phenyl]ethyl}-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990961 |
DrugBank | |
ZINC | ZINC000095920758
|
PDB chain | 3w1x Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|