Structure of PDB 3w1t Chain A Binding Site BS01 |
|
|
Ligand ID | WRO |
InChI | InChI=1S/C14H11F3N2O4/c15-14(16,17)8-3-1-2-7(6-8)4-5-9-10(12(21)22)18-13(23)19-11(9)20/h1-3,6H,4-5H2,(H,21,22)(H2,18,19,20,23) |
InChIKey | KJPHDCMBIHOWFV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)C(F)(F)F)CCC2=C(NC(=O)NC2=O)C(=O)O | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2cccc(c2)C(F)(F)F | CACTVS 3.370 | OC(=O)C1=C(CCc2cccc(c2)C(F)(F)F)C(=O)NC(=O)N1 |
|
Formula | C14 H11 F3 N2 O4 |
Name | 2,6-dioxo-5-{2-[3-(trifluoromethyl)phenyl]ethyl}-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990140 |
DrugBank | |
ZINC | ZINC000095920705
|
PDB chain | 3w1t Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|