Structure of PDB 3vye Chain A Binding Site BS01 |
|
|
Ligand ID | VYE |
InChI | InChI=1S/C23H35ClN4O2/c1-16(2)9-10-26-22(30)17-11-18(13-25-12-17)28-14-21(29)27(15-23(28,3)4)20-8-6-5-7-19(20)24/h5-8,16-18,25H,9-15H2,1-4H3,(H,26,30)/t17-,18+/m0/s1 |
InChIKey | OIPASSZLGANZOF-ZWKOTPCHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC(C)CCNC(=O)[C@@H]1CNC[C@@H](C1)N2CC(=O)N(CC2(C)C)c3ccccc3Cl | CACTVS 3.370 | CC(C)CCNC(=O)[CH]1CNC[CH](C1)N2CC(=O)N(CC2(C)C)c3ccccc3Cl | OpenEye OEToolkits 1.7.6 | CC(C)CCNC(=O)C1CC(CNC1)N2CC(=O)N(CC2(C)C)c3ccccc3Cl | OpenEye OEToolkits 1.7.6 | CC(C)CCNC(=O)[C@H]1C[C@H](CNC1)N2CC(=O)N(CC2(C)C)c3ccccc3Cl | ACDLabs 12.01 | Clc3ccccc3N2C(=O)CN(C1CNCC(C(=O)NCCC(C)C)C1)C(C2)(C)C |
|
Formula | C23 H35 Cl N4 O2 |
Name | (3S,5R)-5-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-N-(3-methylbutyl)piperidine-3-carboxamide |
ChEMBL | CHEMBL2220087 |
DrugBank | |
ZINC | ZINC000095563355
|
PDB chain | 3vye Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|