Structure of PDB 3vv8 Chain A Binding Site BS01 |
|
|
Ligand ID | B02 |
InChI | InChI=1S/C21H21N3O/c1-13-4-3-5-16(10-13)14-6-8-15(9-7-14)17-11-18(17)19-12-20(25)24(2)21(22)23-19/h3-10,12,17-18H,11H2,1-2H3,(H2,22,23)/t17-,18-/m0/s1 |
InChIKey | STUBOTPNCNDBOA-ROUUACIJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1cccc(c1)c2ccc(cc2)[C@@H]3C[C@@H]3C4=CC(=O)N(C(=N4)N)C | OpenEye OEToolkits 1.7.6 | Cc1cccc(c1)c2ccc(cc2)C3CC3C4=CC(=O)N(C(=N4)N)C | CACTVS 3.370 | CN1C(=NC(=CC1=O)[CH]2C[CH]2c3ccc(cc3)c4cccc(C)c4)N | CACTVS 3.370 | CN1C(=NC(=CC1=O)[C@H]2C[C@H]2c3ccc(cc3)c4cccc(C)c4)N | ACDLabs 12.01 | O=C1C=C(N=C(N)N1C)C4CC4c3ccc(c2cccc(c2)C)cc3 |
|
Formula | C21 H21 N3 O |
Name | 2-amino-3-methyl-6-[(1S,2R)-2-(3'-methylbiphenyl-4-yl)cyclopropyl]pyrimidin-4(3H)-one |
ChEMBL | CHEMBL2169939 |
DrugBank | |
ZINC | ZINC000095553010
|
PDB chain | 3vv8 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|